C12H14ClNO — CID 173430500
N-(2,6-dimethylphenyl)-N-prop-1-enylcarbamoyl chloride (PubChem CID 173430500) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-N-prop-1-enylcarbamoyl chloride.
| Compound Name | N-(2,6-dimethylphenyl)-N-prop-1-enylcarbamoyl chloride |
|---|---|
| PubChem CID | 173430500 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | N-(2,6-dimethylphenyl)-N-prop-1-enylcarbamoyl chloride |
| SMILES | CC=CN(C(=O)Cl)c1c(C)cccc1C |
| InChI | InChI=1S/C12H14ClNO/c1-4-8-14(12(13)15)11-9(2)6-5-7-10(11)3/h4-8H,1-3H3 |
| InChIKey | LSBMZUURTHHOFY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|