About [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane
[[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane (PubChem CID 173434220) has the molecular formula C7H15N3O2S
and a molecular weight of 205.28 g/mol. Its IUPAC name is [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane.
Molecular Properties
| Compound Name | [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane |
| PubChem CID | 173434220 |
| Molecular Formula | C7H15N3O2S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane |
| SMILES | C.CC(=NOC(N)=O)C(=S)N(C)C |
| InChI | InChI=1S/C6H11N3O2S.CH4/c1-4(5(12)9(2)3)8-11-6(7)10;/h1-3H3,(H2,7,10);1H4 |
| InChIKey | FIJZJLOGZDLQEC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane?
The IUPAC name of [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane (CID 173434220) is [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane.
What is the SMILES notation for [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane?
The canonical SMILES for [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane is C.CC(=NOC(N)=O)C(=S)N(C)C.
What is the InChIKey of [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane?
The InChIKey is FIJZJLOGZDLQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2S.CH4/c1-4(5(12)9(2)3)8-11-6(7)10;/h1-3H3,(H2,7,10);1H4.
What are the key properties of [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane?
[[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane has a molecular weight of 205.28 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[1-(dimethylamino)-1-sulfanylidenepropan-2-ylidene]amino] carbamate;methane is sourced from PubChem (CID 173434220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).