C12H19NO2 — CID 173435539
3-piperidin-1-ylprop-2-enyl 2-methylprop-2-enoate (PubChem CID 173435539) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-piperidin-1-ylprop-2-enyl 2-methylprop-2-enoate.
| Compound Name | 3-piperidin-1-ylprop-2-enyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173435539 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-piperidin-1-ylprop-2-enyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC=CN1CCCCC1 |
| InChI | InChI=1S/C12H19NO2/c1-11(2)12(14)15-10-6-9-13-7-4-3-5-8-13/h6,9H,1,3-5,7-8,10H2,2H3 |
| InChIKey | YRWSLGXNYXITJY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|