C7H9FO2 — CID 67041236
3-fluoroprop-2-enyl 2-methylprop-2-enoate (PubChem CID 67041236) has the molecular formula C7H9FO2 and a molecular weight of 144.14 g/mol. Its IUPAC name is 3-fluoroprop-2-enyl 2-methylprop-2-enoate.
| Compound Name | 3-fluoroprop-2-enyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67041236 |
| Molecular Formula | C7H9FO2 |
| Molecular Weight | 144.14 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 3-fluoroprop-2-enyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC=CF |
| InChI | InChI=1S/C7H9FO2/c1-6(2)7(9)10-5-3-4-8/h3-4H,1,5H2,2H3 |
| InChIKey | UPMGFXWPUYTCRR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.14 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|