C25H47N3O5 — CID 173437845
N,N-dibutylprop-2-enamide;N,N-diethylprop-2-enamide;5-hydroxy-2-(2-hydroxyethyl)pent-2-enamide (PubChem CID 173437845) has the molecular formula C25H47N3O5 and a molecular weight of 469.67 g/mol. Its IUPAC name is N,N-dibutylprop-2-enamide;N,N-diethylprop-2-enamide;5-hydroxy-2-(2-hydroxyethyl)pent-2-enamide.
| Compound Name | N,N-dibutylprop-2-enamide;N,N-diethylprop-2-enamide;5-hydroxy-2-(2-hydroxyethyl)pent-2-enamide |
|---|---|
| PubChem CID | 173437845 |
| Molecular Formula | C25H47N3O5 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.35 |
| IUPAC Name | N,N-dibutylprop-2-enamide;N,N-diethylprop-2-enamide;5-hydroxy-2-(2-hydroxyethyl)pent-2-enamide |
| SMILES | C=CC(=O)N(CC)CC.C=CC(=O)N(CCCC)CCCC.NC(=O)C(=CCCO)CCO |
| InChI | InChI=1S/C11H21NO.C7H13NO3.C7H13NO/c1-4-7-9-12(10-8-5-2)11(13)6-3;8-7(11)6(3-5-10)2-1-4-9;1-4-7(9)8(5-2)6-3/h6H,3-5,7-10H2,1-2H3;2,9-10H,1,3-5H2,(H2,8,11);4H,1,5-6H2,2-3H3 |
| InChIKey | ARDROXPWJIPZEA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|