C69H123N7O3 — CID 173442563
1-[2-[[bis[(1-octadec-9-enoyl-5,6-dihydro-4H-pyrimidin-2-yl)methyl]amino]methyl]-5,6-dihydro-4H-pyrimidin-1-yl]octadec-9-en-1-one (PubChem CID 173442563) has the molecular formula C69H123N7O3 and a molecular weight of 1098.79 g/mol. Its IUPAC name is 1-[2-[[bis[(1-octadec-9-enoyl-5,6-dihydro-4H-pyrimidin-2-yl)methyl]amino]methyl]-5,6-dihydro-4H-pyrimidin-1-yl]octadec-9-en-1-one.
| Compound Name | 1-[2-[[bis[(1-octadec-9-enoyl-5,6-dihydro-4H-pyrimidin-2-yl)methyl]amino]methyl]-5,6-dihydro-4H-pyrimidin-1-yl]octadec-9-en-1-one |
|---|---|
| PubChem CID | 173442563 |
| Molecular Formula | C69H123N7O3 |
| Molecular Weight | 1098.79 g/mol |
| Exact Mass | 1097.97 |
| IUPAC Name | 1-[2-[[bis[(1-octadec-9-enoyl-5,6-dihydro-4H-pyrimidin-2-yl)methyl]amino]methyl]-5,6-dihydro-4H-pyrimidin-1-yl]octadec-9-en-1-one |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N1CCCN=C1CN(CC1=NCCCN1C(=O)CCCCCCCC=CCCCCCCCC)CC1=NCCCN1C(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C69H123N7O3/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-52-67(77)74-58-49-55-70-64(74)61-73(62-65-71-56-50-59-75(65)68(78)53-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)63-66-72-57-51-60-76(66)69(79)54-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h25-30H,4-24,31-63H2,1-3H3 |
| InChIKey | JOIGKISOEHVFGO-UHFFFAOYSA-N |
| XLogP | 18.29 |
| TPSA | 101.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1098.79 |
| LogP ≤ 5 | 18.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|