C23H39Cl — CID 173445748
3-[1-chloro-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentyl]-2,2-dimethylbicyclo[2.2.1]heptane (PubChem CID 173445748) has the molecular formula C23H39Cl and a molecular weight of 351.02 g/mol. Its IUPAC name is 3-[1-chloro-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentyl]-2,2-dimethylbicyclo[2.2.1]heptane.
| Compound Name | 3-[1-chloro-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentyl]-2,2-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 173445748 |
| Molecular Formula | C23H39Cl |
| Molecular Weight | 351.02 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 3-[1-chloro-5-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)pentyl]-2,2-dimethylbicyclo[2.2.1]heptane |
| SMILES | CC1(C)C2CCC(C2)C1CCCCC(Cl)C1C2CCC(C2)C1(C)C |
| InChI | InChI=1S/C23H39Cl/c1-22(2)17-11-9-15(13-17)19(22)7-5-6-8-20(24)21-16-10-12-18(14-16)23(21,3)4/h15-21H,5-14H2,1-4H3 |
| InChIKey | GDHXTWBLEIWBDY-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.02 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|