About 5-butylacenaphthylene
5-butylacenaphthylene (PubChem CID 173460054) has the molecular formula C16H16
and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-butylacenaphthylene.
Molecular Properties
| Compound Name | 5-butylacenaphthylene |
| PubChem CID | 173460054 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 5-butylacenaphthylene |
| SMILES | CCCCc1ccc2c3c(cccc13)C=C2 |
| InChI | InChI=1S/C16H16/c1-2-3-5-12-8-9-14-11-10-13-6-4-7-15(12)16(13)14/h4,6-11H,2-3,5H2,1H3 |
| InChIKey | BFDIORLVTLVSIG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-butylacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylacenaphthylene?
The IUPAC name of 5-butylacenaphthylene (CID 173460054) is 5-butylacenaphthylene.
What is the SMILES notation for 5-butylacenaphthylene?
The canonical SMILES for 5-butylacenaphthylene is CCCCc1ccc2c3c(cccc13)C=C2.
What is the InChIKey of 5-butylacenaphthylene?
The InChIKey is BFDIORLVTLVSIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16/c1-2-3-5-12-8-9-14-11-10-13-6-4-7-15(12)16(13)14/h4,6-11H,2-3,5H2,1H3.
What are the key properties of 5-butylacenaphthylene?
5-butylacenaphthylene has a molecular weight of 208.30 g/mol, XLogP of 4.67, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylacenaphthylene is sourced from PubChem (CID 173460054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).