C24H48 — CID 173464801
2,3-dimethyldec-5-ene;3,4-dimethyldec-5-ene (PubChem CID 173464801) has the molecular formula C24H48 and a molecular weight of 336.65 g/mol. Its IUPAC name is 2,3-dimethyldec-5-ene;3,4-dimethyldec-5-ene.
| Compound Name | 2,3-dimethyldec-5-ene;3,4-dimethyldec-5-ene |
|---|---|
| PubChem CID | 173464801 |
| Molecular Formula | C24H48 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 336.38 |
| IUPAC Name | 2,3-dimethyldec-5-ene;3,4-dimethyldec-5-ene |
| SMILES | CCCCC=CC(C)C(C)CC.CCCCC=CCC(C)C(C)C |
| InChI | InChI=1S/2C12H24/c1-5-6-7-8-9-10-12(4)11(2)3;1-5-7-8-9-10-12(4)11(3)6-2/h8-9,11-12H,5-7,10H2,1-4H3;9-12H,5-8H2,1-4H3 |
| InChIKey | XTFXIYKMCFBWHU-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|