C11H7ClF6S — CID 173468975
2-[4-chloro-3,5-bis(trifluoromethyl)phenyl]thietane (PubChem CID 173468975) has the molecular formula C11H7ClF6S and a molecular weight of 320.69 g/mol. Its IUPAC name is 2-[4-chloro-3,5-bis(trifluoromethyl)phenyl]thietane.
| Compound Name | 2-[4-chloro-3,5-bis(trifluoromethyl)phenyl]thietane |
|---|---|
| PubChem CID | 173468975 |
| Molecular Formula | C11H7ClF6S |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 2-[4-chloro-3,5-bis(trifluoromethyl)phenyl]thietane |
| SMILES | FC(F)(F)c1cc(C2CCS2)cc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C11H7ClF6S/c12-9-6(10(13,14)15)3-5(8-1-2-19-8)4-7(9)11(16,17)18/h3-4,8H,1-2H2 |
| InChIKey | FMERPRXUTOSPIF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |