C52H72Si — CID 173473387
tris(3,5-ditert-butylphenyl)-(2-methyl-3H-inden-1-yl)silane (PubChem CID 173473387) has the molecular formula C52H72Si and a molecular weight of 725.23 g/mol. Its IUPAC name is tris(3,5-ditert-butylphenyl)-(2-methyl-3H-inden-1-yl)silane.
| Compound Name | tris(3,5-ditert-butylphenyl)-(2-methyl-3H-inden-1-yl)silane |
|---|---|
| PubChem CID | 173473387 |
| Molecular Formula | C52H72Si |
| Molecular Weight | 725.23 g/mol |
| Exact Mass | 724.54 |
| IUPAC Name | tris(3,5-ditert-butylphenyl)-(2-methyl-3H-inden-1-yl)silane |
| SMILES | CC1=C([Si](c2cc(C(C)(C)C)cc(C(C)(C)C)c2)(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2ccccc2C1 |
| InChI | InChI=1S/C52H72Si/c1-34-24-35-22-20-21-23-45(35)46(34)53(42-28-36(47(2,3)4)25-37(29-42)48(5,6)7,43-30-38(49(8,9)10)26-39(31-43)50(11,12)13)44-32-40(51(14,15)16)27-41(33-44)52(17,18)19/h20-23,25-33H,24H2,1-19H3 |
| InChIKey | SPXIIJUTCXRPLC-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.23 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|