C49H72Si — CID 173473768
tris(3,5-ditert-butylphenyl)-(3,5-dimethylcyclopenta-1,4-dien-1-yl)silane (PubChem CID 173473768) has the molecular formula C49H72Si and a molecular weight of 689.20 g/mol. Its IUPAC name is tris(3,5-ditert-butylphenyl)-(3,5-dimethylcyclopenta-1,4-dien-1-yl)silane.
| Compound Name | tris(3,5-ditert-butylphenyl)-(3,5-dimethylcyclopenta-1,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173473768 |
| Molecular Formula | C49H72Si |
| Molecular Weight | 689.20 g/mol |
| Exact Mass | 688.54 |
| IUPAC Name | tris(3,5-ditert-butylphenyl)-(3,5-dimethylcyclopenta-1,4-dien-1-yl)silane |
| SMILES | CC1=CC(C)C=C1[Si](c1cc(C(C)(C)C)cc(C(C)(C)C)c1)(c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C49H72Si/c1-32-21-33(2)43(22-32)50(40-26-34(44(3,4)5)23-35(27-40)45(6,7)8,41-28-36(46(9,10)11)24-37(29-41)47(12,13)14)42-30-38(48(15,16)17)25-39(31-42)49(18,19)20/h21-32H,1-20H3 |
| InChIKey | XSHRDLINRDMZTQ-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.20 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|