C47H35NO2 — CID 173476968
3-[(E)-3-[4-[4-(5-methylcyclohepta-1,3,5,6-tetraen-1-yl)-N-[4-(3-methylphenyl)phenyl]anilino]phenyl]prop-2-enoyl]naphthalene-2-carbaldehyde (PubChem CID 173476968) has the molecular formula C47H35NO2 and a molecular weight of 645.80 g/mol. Its IUPAC name is 3-[(E)-3-[4-[4-(5-methylcyclohepta-1,3,5,6-tetraen-1-yl)-N-[4-(3-methylphenyl)phenyl]anilino]phenyl]prop-2-enoyl]naphthalene-2-carbaldehyde.
| Compound Name | 3-[(E)-3-[4-[4-(5-methylcyclohepta-1,3,5,6-tetraen-1-yl)-N-[4-(3-methylphenyl)phenyl]anilino]phenyl]prop-2-enoyl]naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 173476968 |
| Molecular Formula | C47H35NO2 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | 3-[(E)-3-[4-[4-(5-methylcyclohepta-1,3,5,6-tetraen-1-yl)-N-[4-(3-methylphenyl)phenyl]anilino]phenyl]prop-2-enoyl]naphthalene-2-carbaldehyde |
| SMILES | CC1=C=CC(c2ccc(N(c3ccc(/C=C/C(=O)c4cc5ccccc5cc4C=O)cc3)c3ccc(-c4cccc(C)c4)cc3)cc2)=CC=C1 |
| InChI | InChI=1S/C47H35NO2/c1-33-7-5-11-36(17-13-33)37-18-24-44(25-19-37)48(45-26-20-38(21-27-45)39-12-6-8-34(2)29-39)43-22-14-35(15-23-43)16-28-47(50)46-31-41-10-4-3-9-40(41)30-42(46)32-49/h3-12,14-32H,1-2H3/b28-16+ |
| InChIKey | KANGXJHNCXWEMP-LQKURTRISA-N |
| XLogP | 12.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|