C25H29N3 — CID 173478401
(3Z,6E)-7-methyl-4-[[(Z)-1-phenylbut-2-enylidene]amino]-3-pyridin-2-ylnona-1,3,6-trien-2-amine (PubChem CID 173478401) has the molecular formula C25H29N3 and a molecular weight of 371.53 g/mol. Its IUPAC name is (3Z,6E)-7-methyl-4-[[(Z)-1-phenylbut-2-enylidene]amino]-3-pyridin-2-ylnona-1,3,6-trien-2-amine.
| Compound Name | (3Z,6E)-7-methyl-4-[[(Z)-1-phenylbut-2-enylidene]amino]-3-pyridin-2-ylnona-1,3,6-trien-2-amine |
|---|---|
| PubChem CID | 173478401 |
| Molecular Formula | C25H29N3 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | (3Z,6E)-7-methyl-4-[[(Z)-1-phenylbut-2-enylidene]amino]-3-pyridin-2-ylnona-1,3,6-trien-2-amine |
| SMILES | C=C(N)/C(=C(C/C=C(\C)CC)/N=C(\C=C/C)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C25H29N3/c1-5-12-22(21-13-8-7-9-14-21)28-24(17-16-19(3)6-2)25(20(4)26)23-15-10-11-18-27-23/h5,7-16,18H,4,6,17,26H2,1-3H3/b12-5-,19-16+,25-24-,28-22+ |
| InChIKey | JGRLPOHBJQLOCY-XDWWILKJSA-N |
| XLogP | 6.08 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|