C14H16F3NO — CID 173481194
2-hex-5-enyl-6-(trifluoromethyl)benzamide (PubChem CID 173481194) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-hex-5-enyl-6-(trifluoromethyl)benzamide.
| Compound Name | 2-hex-5-enyl-6-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 173481194 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-hex-5-enyl-6-(trifluoromethyl)benzamide |
| SMILES | C=CCCCCc1cccc(C(F)(F)F)c1C(N)=O |
| InChI | InChI=1S/C14H16F3NO/c1-2-3-4-5-7-10-8-6-9-11(14(15,16)17)12(10)13(18)19/h2,6,8-9H,1,3-5,7H2,(H2,18,19) |
| InChIKey | LBVNIEKCZCEMJA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|