C24H33N6O11P — CID 173482490
methyl 2-[[(2R)-2-[(1S)-2-azido-1-(2,4-dioxopyrimidin-1-yl)ethoxy]-3-hydroxybutoxy]-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]oxybenzoate (PubChem CID 173482490) has the molecular formula C24H33N6O11P and a molecular weight of 612.53 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-[(1S)-2-azido-1-(2,4-dioxopyrimidin-1-yl)ethoxy]-3-hydroxybutoxy]-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]oxybenzoate.
| Compound Name | methyl 2-[[(2R)-2-[(1S)-2-azido-1-(2,4-dioxopyrimidin-1-yl)ethoxy]-3-hydroxybutoxy]-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]oxybenzoate |
|---|---|
| PubChem CID | 173482490 |
| Molecular Formula | C24H33N6O11P |
| Molecular Weight | 612.53 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | methyl 2-[[(2R)-2-[(1S)-2-azido-1-(2,4-dioxopyrimidin-1-yl)ethoxy]-3-hydroxybutoxy]-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphoryl]oxybenzoate |
| SMILES | COC(=O)c1ccccc1OP(=O)(N[C@@H](C)C(=O)OC(C)C)OC[C@@H](O[C@@H](CN=[N+]=[N-])n1ccc(=O)[nH]c1=O)C(C)O |
| InChI | InChI=1S/C24H33N6O11P/c1-14(2)39-22(33)15(3)28-42(36,41-18-9-7-6-8-17(18)23(34)37-5)38-13-19(16(4)31)40-21(12-26-29-25)30-11-10-20(32)27-24(30)35/h6-11,14-16,19,21,31H,12-13H2,1-5H3,(H,28,36)(H,27,32,35)/t15-,16?,19+,21-,42?/m0/s1 |
| InChIKey | DJJPVBCVNOFVLR-RDRGSMLTSA-N |
| XLogP | 2.03 |
| TPSA | 233.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|