C8H13N2ORb — CID 173482628
3,9-diazabicyclo[4.2.1]nonan-9-ylmethanone;rubidium(1+) (PubChem CID 173482628) has the molecular formula C8H13N2ORb and a molecular weight of 238.67 g/mol. Its IUPAC name is 3,9-diazabicyclo[4.2.1]nonan-9-ylmethanone;rubidium(1+).
| Compound Name | 3,9-diazabicyclo[4.2.1]nonan-9-ylmethanone;rubidium(1+) |
|---|---|
| PubChem CID | 173482628 |
| Molecular Formula | C8H13N2ORb |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 3,9-diazabicyclo[4.2.1]nonan-9-ylmethanone;rubidium(1+) |
| SMILES | O=[C-]N1C2CCNCC1CC2.[Rb+] |
| InChI | InChI=1S/C8H13N2O.Rb/c11-6-10-7-1-2-8(10)5-9-4-3-7;/h7-9H,1-5H2;/q-1;+1 |
| InChIKey | JKKMUXXNLCJTFY-UHFFFAOYSA-N |
| XLogP | -3.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|