C21H24Cl2N2 — CID 173485850
4,5-dichloro-1-heptyl-2-(3-methylnaphthalen-1-yl)imidazole (PubChem CID 173485850) has the molecular formula C21H24Cl2N2 and a molecular weight of 375.34 g/mol. Its IUPAC name is 4,5-dichloro-1-heptyl-2-(3-methylnaphthalen-1-yl)imidazole.
| Compound Name | 4,5-dichloro-1-heptyl-2-(3-methylnaphthalen-1-yl)imidazole |
|---|---|
| PubChem CID | 173485850 |
| Molecular Formula | C21H24Cl2N2 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4,5-dichloro-1-heptyl-2-(3-methylnaphthalen-1-yl)imidazole |
| SMILES | CCCCCCCn1c(-c2cc(C)cc3ccccc23)nc(Cl)c1Cl |
| InChI | InChI=1S/C21H24Cl2N2/c1-3-4-5-6-9-12-25-20(23)19(22)24-21(25)18-14-15(2)13-16-10-7-8-11-17(16)18/h7-8,10-11,13-14H,3-6,9,12H2,1-2H3 |
| InChIKey | DAWYPNAKGPAASW-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|