C16H23N3O5S — CID 173488761
methyl 2-[[(1R)-1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropyl]amino]-N-sulfamoylprop-2-enimidate (PubChem CID 173488761) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is methyl 2-[[(1R)-1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropyl]amino]-N-sulfamoylprop-2-enimidate.
| Compound Name | methyl 2-[[(1R)-1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropyl]amino]-N-sulfamoylprop-2-enimidate |
|---|---|
| PubChem CID | 173488761 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | methyl 2-[[(1R)-1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropyl]amino]-N-sulfamoylprop-2-enimidate |
| SMILES | C=C(N[C@@H](c1ccc2c(c1)OCO2)C(C)(C)C)C(=NS(N)(=O)=O)OC |
| InChI | InChI=1S/C16H23N3O5S/c1-10(15(22-5)19-25(17,20)21)18-14(16(2,3)4)11-6-7-12-13(8-11)24-9-23-12/h6-8,14,18H,1,9H2,2-5H3,(H2,17,20,21)/t14-/m0/s1 |
| InChIKey | QTJPZLRACGKVJX-AWEZNQCLSA-N |
| XLogP | 1.85 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|