C12H16O2S2 — CID 170710367
(1S)-1-(1,3-benzodioxol-5-yl)-3-methylbutane-1,3-dithiol (PubChem CID 170710367) has the molecular formula C12H16O2S2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (1S)-1-(1,3-benzodioxol-5-yl)-3-methylbutane-1,3-dithiol.
| Compound Name | (1S)-1-(1,3-benzodioxol-5-yl)-3-methylbutane-1,3-dithiol |
|---|---|
| PubChem CID | 170710367 |
| Molecular Formula | C12H16O2S2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | (1S)-1-(1,3-benzodioxol-5-yl)-3-methylbutane-1,3-dithiol |
| SMILES | CC(C)(S)C[C@H](S)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H16O2S2/c1-12(2,16)6-11(15)8-3-4-9-10(5-8)14-7-13-9/h3-5,11,15-16H,6-7H2,1-2H3/t11-/m0/s1 |
| InChIKey | HGEWKXWRSWGCCO-NSHDSACASA-N |
| XLogP | 3.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|