C21H22F3N5O6S — CID 173488819
3-[[C-[1-[[(1S)-1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethyl]amino]ethenyl]-N-sulfamoylcarbonimidoyl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 173488819) has the molecular formula C21H22F3N5O6S and a molecular weight of 529.50 g/mol. Its IUPAC name is 3-[[C-[1-[[(1S)-1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethyl]amino]ethenyl]-N-sulfamoylcarbonimidoyl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[C-[1-[[(1S)-1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethyl]amino]ethenyl]-N-sulfamoylcarbonimidoyl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 173488819 |
| Molecular Formula | C21H22F3N5O6S |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 3-[[C-[1-[[(1S)-1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethyl]amino]ethenyl]-N-sulfamoylcarbonimidoyl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | C=C(N[C@@H](c1ccc2c(c1)OCO2)C(F)(F)F)C(=NS(N)(=O)=O)Nc1cccc(C(=O)N(C)C)c1O |
| InChI | InChI=1S/C21H22F3N5O6S/c1-11(26-18(21(22,23)24)12-7-8-15-16(9-12)35-10-34-15)19(28-36(25,32)33)27-14-6-4-5-13(17(14)30)20(31)29(2)3/h4-9,18,26,30H,1,10H2,2-3H3,(H,27,28)(H2,25,32,33)/t18-/m0/s1 |
| InChIKey | AXHRCDNVHPDQHZ-SFHVURJKSA-N |
| XLogP | 2.24 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|