C24H30F3N5O4S — CID 173488784
3-[[C-[1-[[2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]amino]ethenyl]-N-sulfamoylcarbonimidoyl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 173488784) has the molecular formula C24H30F3N5O4S and a molecular weight of 541.60 g/mol. Its IUPAC name is 3-[[C-[1-[[2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]amino]ethenyl]-N-sulfamoylcarbonimidoyl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[C-[1-[[2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]amino]ethenyl]-N-sulfamoylcarbonimidoyl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 173488784 |
| Molecular Formula | C24H30F3N5O4S |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 3-[[C-[1-[[2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]amino]ethenyl]-N-sulfamoylcarbonimidoyl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | C=C(NC(c1cccc(C(F)(F)F)c1)C(C)(C)C)C(=NS(N)(=O)=O)Nc1cccc(C(=O)N(C)C)c1O |
| InChI | InChI=1S/C24H30F3N5O4S/c1-14(29-20(23(2,3)4)15-9-7-10-16(13-15)24(25,26)27)21(31-37(28,35)36)30-18-12-8-11-17(19(18)33)22(34)32(5)6/h7-13,20,29,33H,1H2,2-6H3,(H,30,31)(H2,28,35,36) |
| InChIKey | OWJGOYOOSWWJJI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|