C16H21N5OS — CID 17348953
N-(cyclohexylideneamino)-3-(2-phenoxyethylsulfanyl)-1H-1,2,4-triazol-5-amine (PubChem CID 17348953) has the molecular formula C16H21N5OS and a molecular weight of 331.44 g/mol. Its IUPAC name is N-(cyclohexylideneamino)-3-(2-phenoxyethylsulfanyl)-1H-1,2,4-triazol-5-amine.
| Compound Name | N-(cyclohexylideneamino)-3-(2-phenoxyethylsulfanyl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 17348953 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-(cyclohexylideneamino)-3-(2-phenoxyethylsulfanyl)-1H-1,2,4-triazol-5-amine |
| SMILES | c1ccc(OCCSc2n[nH]c(NN=C3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C16H21N5OS/c1-3-7-13(8-4-1)18-19-15-17-16(21-20-15)23-12-11-22-14-9-5-2-6-10-14/h2,5-6,9-10H,1,3-4,7-8,11-12H2,(H2,17,19,20,21) |
| InChIKey | AWLTUYNWXDURGX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|