C16H19N7O3S — CID 17369536
2-[[5-(2-cyclohexylidenehydrazinyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide (PubChem CID 17369536) has the molecular formula C16H19N7O3S and a molecular weight of 389.44 g/mol. Its IUPAC name is 2-[[5-(2-cyclohexylidenehydrazinyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(2-cyclohexylidenehydrazinyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 17369536 |
| Molecular Formula | C16H19N7O3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[[5-(2-cyclohexylidenehydrazinyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
| SMILES | O=C(CSc1n[nH]c(NN=C2CCCCC2)n1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N7O3S/c24-14(17-12-8-4-5-9-13(12)23(25)26)10-27-16-18-15(21-22-16)20-19-11-6-2-1-3-7-11/h4-5,8-9H,1-3,6-7,10H2,(H,17,24)(H2,18,20,21,22) |
| InChIKey | KURBHLSCJSOYFJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|