C24H30N2O3 — CID 173490472
8,9-diamino-9,9-bis(4-methoxyphenyl)-7-methylnona-1,4-dien-3-one (PubChem CID 173490472) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 8,9-diamino-9,9-bis(4-methoxyphenyl)-7-methylnona-1,4-dien-3-one.
| Compound Name | 8,9-diamino-9,9-bis(4-methoxyphenyl)-7-methylnona-1,4-dien-3-one |
|---|---|
| PubChem CID | 173490472 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 8,9-diamino-9,9-bis(4-methoxyphenyl)-7-methylnona-1,4-dien-3-one |
| SMILES | C=CC(=O)C=CCC(C)C(N)C(N)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H30N2O3/c1-5-20(27)8-6-7-17(2)23(25)24(26,18-9-13-21(28-3)14-10-18)19-11-15-22(29-4)16-12-19/h5-6,8-17,23H,1,7,25-26H2,2-4H3 |
| InChIKey | FFQGCTHOXQKMOG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|