About (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal
(Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal (PubChem CID 173493810) has the molecular formula C6H4N4OS
and a molecular weight of 180.19 g/mol. Its IUPAC name is (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal.
Molecular Properties
| Compound Name | (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal |
| PubChem CID | 173493810 |
| Molecular Formula | C6H4N4OS |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal |
| SMILES | [N-]=[N+]=N/C(C=O)=C\c1cncs1 |
| InChI | InChI=1S/C6H4N4OS/c7-10-9-5(3-11)1-6-2-8-4-12-6/h1-4H/b5-1- |
| InChIKey | YGKSAKNLALKTOQ-KTAJNNJTSA-N |
| XLogP | 1.99 |
| TPSA | 78.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal?
The IUPAC name of (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal (CID 173493810) is (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal.
What is the SMILES notation for (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal?
The canonical SMILES for (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal is [N-]=[N+]=N/C(C=O)=C\c1cncs1.
What is the InChIKey of (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal?
The InChIKey is YGKSAKNLALKTOQ-KTAJNNJTSA-N. The full InChI is InChI=1S/C6H4N4OS/c7-10-9-5(3-11)1-6-2-8-4-12-6/h1-4H/b5-1-.
What are the key properties of (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal?
(Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal has a molecular weight of 180.19 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-azido-3-(1,3-thiazol-5-yl)prop-2-enal is sourced from PubChem (CID 173493810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).