C20H23N7O3 — CID 173494818
tert-butyl N-[6-[[[2-(1-methyltetrazol-5-yl)phenyl]methylideneamino]oxymethyl]-2-pyridinyl]carbamate (PubChem CID 173494818) has the molecular formula C20H23N7O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is tert-butyl N-[6-[[[2-(1-methyltetrazol-5-yl)phenyl]methylideneamino]oxymethyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[[[2-(1-methyltetrazol-5-yl)phenyl]methylideneamino]oxymethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 173494818 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | tert-butyl N-[6-[[[2-(1-methyltetrazol-5-yl)phenyl]methylideneamino]oxymethyl]-2-pyridinyl]carbamate |
| SMILES | Cn1nnnc1-c1ccccc1C=NOCc1cccc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C20H23N7O3/c1-20(2,3)30-19(28)23-17-11-7-9-15(22-17)13-29-21-12-14-8-5-6-10-16(14)18-24-25-26-27(18)4/h5-12H,13H2,1-4H3,(H,22,23,28) |
| InChIKey | DYGYOUPHVUUVOZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|