C21H23N5O5 — CID 131741639
tert-butyl N-[6-[[(E)-[(2-methyl-5-oxo-1,2,4-oxadiazol-3-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate (PubChem CID 131741639) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is tert-butyl N-[6-[[(E)-[(2-methyl-5-oxo-1,2,4-oxadiazol-3-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[[(E)-[(2-methyl-5-oxo-1,2,4-oxadiazol-3-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 131741639 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | tert-butyl N-[6-[[(E)-[(2-methyl-5-oxo-1,2,4-oxadiazol-3-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
| SMILES | Cn1oc(=O)nc1/C(=N/OCc1cccc(NC(=O)OC(C)(C)C)n1)c1ccccc1 |
| InChI | InChI=1S/C21H23N5O5/c1-21(2,3)30-19(27)23-16-12-8-11-15(22-16)13-29-25-17(14-9-6-5-7-10-14)18-24-20(28)31-26(18)4/h5-12H,13H2,1-4H3,(H,22,23,27)/b25-17+ |
| InChIKey | BBHQLXDBYDZTFB-KOEQRZSOSA-N |
| XLogP | 3.08 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|