C20H25N5O4 — CID 137071321
tert-butyl N-[6-[[(E)-[2-(hydroxyamino)-2-methylimino-1-phenylethylidene]amino]oxymethyl]-2-pyridinyl]carbamate (PubChem CID 137071321) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is tert-butyl N-[6-[[(E)-[2-(hydroxyamino)-2-methylimino-1-phenylethylidene]amino]oxymethyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[[(E)-[2-(hydroxyamino)-2-methylimino-1-phenylethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 137071321 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | tert-butyl N-[6-[[(E)-[2-(hydroxyamino)-2-methylimino-1-phenylethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
| SMILES | C/N=C(NO)/C(=N/OCc1cccc(NC(=O)OC(C)(C)C)n1)c1ccccc1 |
| InChI | InChI=1S/C20H25N5O4/c1-20(2,3)29-19(26)23-16-12-8-11-15(22-16)13-28-25-17(18(21-4)24-27)14-9-6-5-7-10-14/h5-12,27H,13H2,1-4H3,(H,21,24)(H,22,23,26)/b25-17+ |
| InChIKey | POQUJWCIFWNDKZ-KOEQRZSOSA-N |
| XLogP | 3.36 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|