C24H33N7O5 — CID 89349698
(4,4-dimethoxy-3-methylpentan-2-yl) N-[6-[[(Z)-[2-[diazenyl(methyl)amino]-2-imino-1-phenylethylidene]amino]oxymethyl]-2-pyridinyl]carbamate (PubChem CID 89349698) has the molecular formula C24H33N7O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is (4,4-dimethoxy-3-methylpentan-2-yl) N-[6-[[(Z)-[2-[diazenyl(methyl)amino]-2-imino-1-phenylethylidene]amino]oxymethyl]-2-pyridinyl]carbamate.
| Compound Name | (4,4-dimethoxy-3-methylpentan-2-yl) N-[6-[[(Z)-[2-[diazenyl(methyl)amino]-2-imino-1-phenylethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 89349698 |
| Molecular Formula | C24H33N7O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | (4,4-dimethoxy-3-methylpentan-2-yl) N-[6-[[(Z)-[2-[diazenyl(methyl)amino]-2-imino-1-phenylethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
| SMILES | [H]/N=C(C(=N\OCc1cccc(NC(=O)OC(C)C(C)C(C)(OC)OC)n1)/c1ccccc1)\N(C)/N=N/[H] |
| InChI | InChI=1S/C24H33N7O5/c1-16(24(3,33-5)34-6)17(2)36-23(32)28-20-14-10-13-19(27-20)15-35-29-21(22(25)31(4)30-26)18-11-8-7-9-12-18/h7-14,16-17,25-26H,15H2,1-6H3,(H,27,28,32)/b25-22-,29-21-,30-26+ |
| InChIKey | FAOXCDFWPHRWQW-PUDMIEQESA-N |
| XLogP | 4.44 |
| TPSA | 154.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|