C20H20N4O4 — CID 89499308
but-3-ynyl-[6-[[(Z)-[2-(methylamino)-2-oxo-1-phenylethylidene]amino]oxymethyl]-2-pyridinyl]carbamic acid (PubChem CID 89499308) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is but-3-ynyl-[6-[[(Z)-[2-(methylamino)-2-oxo-1-phenylethylidene]amino]oxymethyl]-2-pyridinyl]carbamic acid.
| Compound Name | but-3-ynyl-[6-[[(Z)-[2-(methylamino)-2-oxo-1-phenylethylidene]amino]oxymethyl]-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 89499308 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | but-3-ynyl-[6-[[(Z)-[2-(methylamino)-2-oxo-1-phenylethylidene]amino]oxymethyl]-2-pyridinyl]carbamic acid |
| SMILES | C#CCCN(C(=O)O)c1cccc(CO/N=C(\C(=O)NC)c2ccccc2)n1 |
| InChI | InChI=1S/C20H20N4O4/c1-3-4-13-24(20(26)27)17-12-8-11-16(22-17)14-28-23-18(19(25)21-2)15-9-6-5-7-10-15/h1,5-12H,4,13-14H2,2H3,(H,21,25)(H,26,27)/b23-18- |
| InChIKey | ZGDWZERKNBFBIB-NKFKGCMQSA-N |
| XLogP | 2.26 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|