C29H37N5O5 — CID 140660332
tert-butyl N-(2-cyclohexylethyl)-N-[6-[[(Z)-[(4-methyl-5-oxo-1,2,4-oxadiazol-3-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate (PubChem CID 140660332) has the molecular formula C29H37N5O5 and a molecular weight of 535.65 g/mol. Its IUPAC name is tert-butyl N-(2-cyclohexylethyl)-N-[6-[[(Z)-[(4-methyl-5-oxo-1,2,4-oxadiazol-3-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-(2-cyclohexylethyl)-N-[6-[[(Z)-[(4-methyl-5-oxo-1,2,4-oxadiazol-3-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 140660332 |
| Molecular Formula | C29H37N5O5 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | tert-butyl N-(2-cyclohexylethyl)-N-[6-[[(Z)-[(4-methyl-5-oxo-1,2,4-oxadiazol-3-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
| SMILES | Cn1c(/C(=N\OCc2cccc(N(CCC3CCCCC3)C(=O)OC(C)(C)C)n2)c2ccccc2)noc1=O |
| InChI | InChI=1S/C29H37N5O5/c1-29(2,3)38-28(36)34(19-18-21-12-7-5-8-13-21)24-17-11-16-23(30-24)20-37-31-25(22-14-9-6-10-15-22)26-32-39-27(35)33(26)4/h6,9-11,14-17,21H,5,7-8,12-13,18-20H2,1-4H3/b31-25- |
| InChIKey | JPXFNLYEQJCJFY-GDWJVWIDSA-N |
| XLogP | 5.45 |
| TPSA | 112.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|