C19H29BrN2O2 — CID 67189605
[6-(bromomethyl)-2-pyridinyl]-(2-cyclohexyl-3,3-dimethylbutyl)carbamic acid (PubChem CID 67189605) has the molecular formula C19H29BrN2O2 and a molecular weight of 397.36 g/mol. Its IUPAC name is [6-(bromomethyl)-2-pyridinyl]-(2-cyclohexyl-3,3-dimethylbutyl)carbamic acid.
| Compound Name | [6-(bromomethyl)-2-pyridinyl]-(2-cyclohexyl-3,3-dimethylbutyl)carbamic acid |
|---|---|
| PubChem CID | 67189605 |
| Molecular Formula | C19H29BrN2O2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [6-(bromomethyl)-2-pyridinyl]-(2-cyclohexyl-3,3-dimethylbutyl)carbamic acid |
| SMILES | CC(C)(C)C(CN(C(=O)O)c1cccc(CBr)n1)C1CCCCC1 |
| InChI | InChI=1S/C19H29BrN2O2/c1-19(2,3)16(14-8-5-4-6-9-14)13-22(18(23)24)17-11-7-10-15(12-20)21-17/h7,10-11,14,16H,4-6,8-9,12-13H2,1-3H3,(H,23,24) |
| InChIKey | WAZYMSHMOYDPEB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|