C21H27N7O4 — CID 136930939
1-ethoxypropan-2-yl N-[6-[[(Z)-[(1-methyl-2,3-dihydrotetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate (PubChem CID 136930939) has the molecular formula C21H27N7O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl N-[6-[[(Z)-[(1-methyl-2,3-dihydrotetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate.
| Compound Name | 1-ethoxypropan-2-yl N-[6-[[(Z)-[(1-methyl-2,3-dihydrotetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 136930939 |
| Molecular Formula | C21H27N7O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 1-ethoxypropan-2-yl N-[6-[[(Z)-[(1-methyl-2,3-dihydrotetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]carbamate |
| SMILES | CCOCC(C)OC(=O)Nc1cccc(CO/N=C(\C2=NNNN2C)c2ccccc2)n1 |
| InChI | InChI=1S/C21H27N7O4/c1-4-30-13-15(2)32-21(29)23-18-12-8-11-17(22-18)14-31-25-19(16-9-6-5-7-10-16)20-24-26-27-28(20)3/h5-12,15,26-27H,4,13-14H2,1-3H3,(H,22,23,29)/b25-19- |
| InChIKey | NIQSLUVKXKXUAM-PLRJNAJWSA-N |
| XLogP | 2.24 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|