C23H29N7O4 — CID 136930920
2-(5,5-dimethyl-1,3-dioxan-2-yl)-N-[6-[[(Z)-[(1-methyl-2,3-dihydrotetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]acetamide (PubChem CID 136930920) has the molecular formula C23H29N7O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is 2-(5,5-dimethyl-1,3-dioxan-2-yl)-N-[6-[[(Z)-[(1-methyl-2,3-dihydrotetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]acetamide.
| Compound Name | 2-(5,5-dimethyl-1,3-dioxan-2-yl)-N-[6-[[(Z)-[(1-methyl-2,3-dihydrotetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 136930920 |
| Molecular Formula | C23H29N7O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 2-(5,5-dimethyl-1,3-dioxan-2-yl)-N-[6-[[(Z)-[(1-methyl-2,3-dihydrotetrazol-5-yl)-phenylmethylidene]amino]oxymethyl]-2-pyridinyl]acetamide |
| SMILES | CN1NNN=C1/C(=N\OCc1cccc(NC(=O)CC2OCC(C)(C)CO2)n1)c1ccccc1 |
| InChI | InChI=1S/C23H29N7O4/c1-23(2)14-32-20(33-15-23)12-19(31)25-18-11-7-10-17(24-18)13-34-27-21(16-8-5-4-6-9-16)22-26-28-29-30(22)3/h4-11,20,28-29H,12-15H2,1-3H3,(H,24,25,31)/b27-21- |
| InChIKey | SYIXOQCQMRBTJU-MEFGMAGPSA-N |
| XLogP | 2.00 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|