C25H27NO4S — CID 17354185
N-(2-benzylsulfanyl-2-phenylethyl)-3,4,5-trimethoxybenzamide (PubChem CID 17354185) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is N-(2-benzylsulfanyl-2-phenylethyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(2-benzylsulfanyl-2-phenylethyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 17354185 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-(2-benzylsulfanyl-2-phenylethyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(SCc2ccccc2)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H27NO4S/c1-28-21-14-20(15-22(29-2)24(21)30-3)25(27)26-16-23(19-12-8-5-9-13-19)31-17-18-10-6-4-7-11-18/h4-15,23H,16-17H2,1-3H3,(H,26,27) |
| InChIKey | BOKUJBNYGKNEGN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |