C15H21BrN2O5 — CID 17357979
3-bromo-N'-(3-ethoxypropanoyl)-4-(2-methoxyethoxy)benzohydrazide (PubChem CID 17357979) has the molecular formula C15H21BrN2O5 and a molecular weight of 389.25 g/mol. Its IUPAC name is 3-bromo-N'-(3-ethoxypropanoyl)-4-(2-methoxyethoxy)benzohydrazide.
| Compound Name | 3-bromo-N'-(3-ethoxypropanoyl)-4-(2-methoxyethoxy)benzohydrazide |
|---|---|
| PubChem CID | 17357979 |
| Molecular Formula | C15H21BrN2O5 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 3-bromo-N'-(3-ethoxypropanoyl)-4-(2-methoxyethoxy)benzohydrazide |
| SMILES | CCOCCC(=O)NNC(=O)c1ccc(OCCOC)c(Br)c1 |
| InChI | InChI=1S/C15H21BrN2O5/c1-3-22-7-6-14(19)17-18-15(20)11-4-5-13(12(16)10-11)23-9-8-21-2/h4-5,10H,3,6-9H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | MQQQXLBASQDVQH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|