C20H13Cl2N3O2S — CID 17368080
(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)prop-2-enamide (PubChem CID 17368080) has the molecular formula C20H13Cl2N3O2S and a molecular weight of 430.32 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17368080 |
| Molecular Formula | C20H13Cl2N3O2S |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)prop-2-enamide |
| SMILES | Cc1ccc2nsnc2c1NC(=O)/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C20H13Cl2N3O2S/c1-11-2-7-16-20(25-28-24-16)19(11)23-18(26)9-5-13-4-8-17(27-13)14-6-3-12(21)10-15(14)22/h2-10H,1H3,(H,23,26)/b9-5+ |
| InChIKey | OEWQNUDFMDYLDR-WEVVVXLNSA-N |
| XLogP | 6.22 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|