C28H30N7O8PS2 — CID 174002754
2-cyanoethyl [(2R,3R,5R)-2-(hydroxymethyl)-5-[6-[(2-phenoxyacetyl)amino]purin-9-yl]oxolan-3-yl] 2-(pyridin-2-yldisulfanyl)ethyl phosphate (PubChem CID 174002754) has the molecular formula C28H30N7O8PS2 and a molecular weight of 687.70 g/mol. Its IUPAC name is 2-cyanoethyl [(2R,3R,5R)-2-(hydroxymethyl)-5-[6-[(2-phenoxyacetyl)amino]purin-9-yl]oxolan-3-yl] 2-(pyridin-2-yldisulfanyl)ethyl phosphate.
| Compound Name | 2-cyanoethyl [(2R,3R,5R)-2-(hydroxymethyl)-5-[6-[(2-phenoxyacetyl)amino]purin-9-yl]oxolan-3-yl] 2-(pyridin-2-yldisulfanyl)ethyl phosphate |
|---|---|
| PubChem CID | 174002754 |
| Molecular Formula | C28H30N7O8PS2 |
| Molecular Weight | 687.70 g/mol |
| Exact Mass | 687.13 |
| IUPAC Name | 2-cyanoethyl [(2R,3R,5R)-2-(hydroxymethyl)-5-[6-[(2-phenoxyacetyl)amino]purin-9-yl]oxolan-3-yl] 2-(pyridin-2-yldisulfanyl)ethyl phosphate |
| SMILES | N#CCCOP(=O)(OCCSSc1ccccn1)O[C@@H]1C[C@H](n2cnc3c(NC(=O)COc4ccccc4)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C28H30N7O8PS2/c29-10-6-12-40-44(38,41-13-14-45-46-24-9-4-5-11-30-24)43-21-15-25(42-22(21)16-36)35-19-33-26-27(31-18-32-28(26)35)34-23(37)17-39-20-7-2-1-3-8-20/h1-5,7-9,11,18-19,21-22,25,36H,6,12-17H2,(H,31,32,34,37)/t21-,22-,25-,44?/m1/s1 |
| InChIKey | UFVQLUVBXXUBEO-NRKZBMHTSA-N |
| XLogP | 4.40 |
| TPSA | 192.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|