C25H24BClN2O5 — CID 174012432
[[5-benzyl-3-[3-(5-chloro-2-methoxyphenyl)phenyl]-4H-1,2-oxazole-5-carbonyl]amino]methylboronic acid (PubChem CID 174012432) has the molecular formula C25H24BClN2O5 and a molecular weight of 478.74 g/mol. Its IUPAC name is [[5-benzyl-3-[3-(5-chloro-2-methoxyphenyl)phenyl]-4H-1,2-oxazole-5-carbonyl]amino]methylboronic acid.
| Compound Name | [[5-benzyl-3-[3-(5-chloro-2-methoxyphenyl)phenyl]-4H-1,2-oxazole-5-carbonyl]amino]methylboronic acid |
|---|---|
| PubChem CID | 174012432 |
| Molecular Formula | C25H24BClN2O5 |
| Molecular Weight | 478.74 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | [[5-benzyl-3-[3-(5-chloro-2-methoxyphenyl)phenyl]-4H-1,2-oxazole-5-carbonyl]amino]methylboronic acid |
| SMILES | COc1ccc(Cl)cc1-c1cccc(C2=NOC(Cc3ccccc3)(C(=O)NCB(O)O)C2)c1 |
| InChI | InChI=1S/C25H24BClN2O5/c1-33-23-11-10-20(27)13-21(23)18-8-5-9-19(12-18)22-15-25(34-29-22,24(30)28-16-26(31)32)14-17-6-3-2-4-7-17/h2-13,31-32H,14-16H2,1H3,(H,28,30) |
| InChIKey | PMPBKZYIPRIYCK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.74 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|