About CID 174029125
CID 174029125 (PubChem CID 174029125) has the molecular formula C17H28B
and a molecular weight of 243.22 g/mol.
Molecular Properties
| Compound Name | CID 174029125 |
| PubChem CID | 174029125 |
| Molecular Formula | C17H28B |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | — |
| SMILES | C[B]c1cc(C(C)C)c(C(C)(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C17H28B/c1-11(2)14-9-13(18-8)10-15(12(3)4)16(14)17(5,6)7/h9-12H,1-8H3 |
| InChIKey | HTIKUEAHYRXGEF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174029125 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174029125?
The IUPAC name of CID 174029125 (CID 174029125) is not available.
What is the SMILES notation for CID 174029125?
The canonical SMILES for CID 174029125 is C[B]c1cc(C(C)C)c(C(C)(C)C)c(C(C)C)c1.
What is the InChIKey of CID 174029125?
The InChIKey is HTIKUEAHYRXGEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28B/c1-11(2)14-9-13(18-8)10-15(12(3)4)16(14)17(5,6)7/h9-12H,1-8H3.
What are the key properties of CID 174029125?
CID 174029125 has a molecular weight of 243.22 g/mol, XLogP of 4.61, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174029125 is sourced from PubChem (CID 174029125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).