C32H30BN2O2 — CID 174029780
CID 174029780 (PubChem CID 174029780) has the molecular formula C32H30BN2O2 and a molecular weight of 485.42 g/mol.
| Compound Name | CID 174029780 |
|---|---|
| PubChem CID | 174029780 |
| Molecular Formula | C32H30BN2O2 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c2ccccc12 |
| InChI | InChI=1S/C32H30BN2O2/c1-31(2,36)32(3,4)37-33-27-20-19-26(24-17-11-12-18-25(24)27)29-21-28(22-13-7-5-8-14-22)34-30(35-29)23-15-9-6-10-16-23/h5-21,36H,1-4H3 |
| InChIKey | DIVJQTDRECKUNU-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|