About CID 152974110
CID 152974110 (PubChem CID 152974110) has the molecular formula C27H26BFN3O2
and a molecular weight of 454.33 g/mol.
Molecular Properties
| Compound Name | CID 152974110 |
| PubChem CID | 152974110 |
| Molecular Formula | C27H26BFN3O2 |
| Molecular Weight | 454.33 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1ccc(F)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C27H26BFN3O2/c1-26(2,33)27(3,4)34-28-20-15-16-22(29)21(17-20)25-31-23(18-11-7-5-8-12-18)30-24(32-25)19-13-9-6-10-14-19/h5-17,33H,1-4H3 |
| InChIKey | GIMZZRWFZZWULE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 152974110 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 152974110?
The IUPAC name of CID 152974110 (CID 152974110) is not available.
What is the SMILES notation for CID 152974110?
The canonical SMILES for CID 152974110 is CC(C)(O)C(C)(C)O[B]c1ccc(F)c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1.
What is the InChIKey of CID 152974110?
The InChIKey is GIMZZRWFZZWULE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26BFN3O2/c1-26(2,33)27(3,4)34-28-20-15-16-22(29)21(17-20)25-31-23(18-11-7-5-8-12-18)30-24(32-25)19-13-9-6-10-14-19/h5-17,33H,1-4H3.
What are the key properties of CID 152974110?
CID 152974110 has a molecular weight of 454.33 g/mol, XLogP of 4.82, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 152974110 is sourced from PubChem (CID 152974110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).