C20H25N3O2Si — CID 174030336
6-[(8-amino-10,10-dimethylbenzo[b][1,4]benzazasilin-2-ylidene)amino]hexanoic acid (PubChem CID 174030336) has the molecular formula C20H25N3O2Si and a molecular weight of 367.53 g/mol. Its IUPAC name is 6-[(8-amino-10,10-dimethylbenzo[b][1,4]benzazasilin-2-ylidene)amino]hexanoic acid.
| Compound Name | 6-[(8-amino-10,10-dimethylbenzo[b][1,4]benzazasilin-2-ylidene)amino]hexanoic acid |
|---|---|
| PubChem CID | 174030336 |
| Molecular Formula | C20H25N3O2Si |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 6-[(8-amino-10,10-dimethylbenzo[b][1,4]benzazasilin-2-ylidene)amino]hexanoic acid |
| SMILES | C[Si]1(C)C2=C/C(=N/CCCCCC(=O)O)C=CC2=Nc2ccc(N)cc21 |
| InChI | InChI=1S/C20H25N3O2Si/c1-26(2)18-12-14(21)7-9-16(18)23-17-10-8-15(13-19(17)26)22-11-5-3-4-6-20(24)25/h7-10,12-13H,3-6,11,21H2,1-2H3,(H,24,25)/b22-15+ |
| InChIKey | WEVMPRQWTBMXKK-PXLXIMEGSA-N |
| XLogP | 3.39 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|