C9H15N5O3 — CID 154090654
5-[(2,6-diamino-1-hydroxypyrimidin-4-ylidene)amino]pentanoic acid (PubChem CID 154090654) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 5-[(2,6-diamino-1-hydroxypyrimidin-4-ylidene)amino]pentanoic acid.
| Compound Name | 5-[(2,6-diamino-1-hydroxypyrimidin-4-ylidene)amino]pentanoic acid |
|---|---|
| PubChem CID | 154090654 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 5-[(2,6-diamino-1-hydroxypyrimidin-4-ylidene)amino]pentanoic acid |
| SMILES | Nc1c/c(=N/CCCCC(=O)O)nc(N)n1O |
| InChI | InChI=1S/C9H15N5O3/c10-6-5-7(13-9(11)14(6)17)12-4-2-1-3-8(15)16/h5,17H,1-4,10H2,(H,15,16)(H2,11,12,13) |
| InChIKey | RNSFITXMYFXYAC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|