C17H32BN5O6S — CID 174040629
CID 174040629 (PubChem CID 174040629) has the molecular formula C17H32BN5O6S and a molecular weight of 445.35 g/mol.
| Compound Name | CID 174040629 |
|---|---|
| PubChem CID | 174040629 |
| Molecular Formula | C17H32BN5O6S |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | — |
| SMILES | [B]c1c(CN2CCS(=O)(=O)CC2)nnn1CCOCCOCCOCCOCCN |
| InChI | InChI=1S/C17H32BN5O6S/c18-17-16(15-22-3-13-30(24,25)14-4-22)20-21-23(17)2-6-27-8-10-29-12-11-28-9-7-26-5-1-19/h1-15,19H2 |
| InChIKey | CQCWGVVXSVTRMH-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|