C26H27B7F3N5O2 — CID 174041923
CID 174041923 (PubChem CID 174041923) has the molecular formula C26H27B7F3N5O2 and a molecular weight of 574.21 g/mol.
| Compound Name | CID 174041923 |
|---|---|
| PubChem CID | 174041923 |
| Molecular Formula | C26H27B7F3N5O2 |
| Molecular Weight | 574.21 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(C([B])([B])N2CCC(CCOC(=O)N3[C@H](C)CN(c4cnc(C(F)(F)F)cn4)C[C@H]3C)CC2)c([B])c1[B] |
| InChI | InChI=1S/C26H27B7F3N5O2/c1-13-11-39(17-10-37-16(9-38-17)26(34,35)36)12-14(2)41(13)24(42)43-8-5-15-3-6-40(7-4-15)25(32,33)18-19(27)21(29)23(31)22(30)20(18)28/h9-10,13-15H,3-8,11-12H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | LNZKOWSKYRIGLR-ZIAGYGMSSA-N |
| XLogP | -2.25 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.21 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|