C17H22N2Si — CID 174047847
1-ethenylsilyl-N,N'-dimethyl-N,N'-diphenylmethanediamine (PubChem CID 174047847) has the molecular formula C17H22N2Si and a molecular weight of 282.46 g/mol. Its IUPAC name is 1-ethenylsilyl-N,N'-dimethyl-N,N'-diphenylmethanediamine.
| Compound Name | 1-ethenylsilyl-N,N'-dimethyl-N,N'-diphenylmethanediamine |
|---|---|
| PubChem CID | 174047847 |
| Molecular Formula | C17H22N2Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-ethenylsilyl-N,N'-dimethyl-N,N'-diphenylmethanediamine |
| SMILES | C=C[SiH2]C(N(C)c1ccccc1)N(C)c1ccccc1 |
| InChI | InChI=1S/C17H22N2Si/c1-4-20-17(18(2)15-11-7-5-8-12-15)19(3)16-13-9-6-10-14-16/h4-14,17H,1,20H2,2-3H3 |
| InChIKey | CQOGYDCLRGOGJC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|