C15H21N3O2S2 — CID 17404835
1-[1-(1,3-benzothiazol-2-yl)-3-methylsulfanylpropyl]-3-(2-methoxyethyl)urea (PubChem CID 17404835) has the molecular formula C15H21N3O2S2 and a molecular weight of 339.49 g/mol. Its IUPAC name is 1-[1-(1,3-benzothiazol-2-yl)-3-methylsulfanylpropyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[1-(1,3-benzothiazol-2-yl)-3-methylsulfanylpropyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 17404835 |
| Molecular Formula | C15H21N3O2S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1-[1-(1,3-benzothiazol-2-yl)-3-methylsulfanylpropyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)NC(CCSC)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H21N3O2S2/c1-20-9-8-16-15(19)18-12(7-10-21-2)14-17-11-5-3-4-6-13(11)22-14/h3-6,12H,7-10H2,1-2H3,(H2,16,18,19) |
| InChIKey | IPIBBIRGHXDHBW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|