About potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate
potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate (PubChem CID 174052012) has the molecular formula C9H11B3F12KO2-3
and a molecular weight of 450.70 g/mol. Its IUPAC name is potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate.
Molecular Properties
| Compound Name | potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate |
| PubChem CID | 174052012 |
| Molecular Formula | C9H11B3F12KO2-3 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate |
| SMILES | F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.[CH2-]OCc1ccc(OC)cc1.[K+] |
| InChI | InChI=1S/C9H11O2.3BF4.K/c1-10-7-8-3-5-9(11-2)6-4-8;3*2-1(3,4)5;/h3-6H,1,7H2,2H3;;;;/q4*-1;+1 |
| InChIKey | CCYVYKNTFXTDSP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate?
The IUPAC name of potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate (CID 174052012) is potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate.
What is the SMILES notation for potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate?
The canonical SMILES for potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate is F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.[CH2-]OCc1ccc(OC)cc1.[K+].
What is the InChIKey of potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate?
The InChIKey is CCYVYKNTFXTDSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O2.3BF4.K/c1-10-7-8-3-5-9(11-2)6-4-8;3*2-1(3,4)5;/h3-6H,1,7H2,2H3;;;;/q4*-1;+1.
What are the key properties of potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate?
potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate has a molecular weight of 450.70 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;1-(methanidyloxymethyl)-4-methoxybenzene;tritetrafluoroborate is sourced from PubChem (CID 174052012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).